Products 1344109-54-1
CAS 1344109-54-1 appears in our catalog under these names: 3,5-Difluoro-4-(propan-2-yloxy)benzoic acid, 95%, 3，5–Difluoro–4–isopropoxybenzoic acid, 3，5-Difluoro-4-isopropoxybenzoic acid, 97%, 97%, 3,5-Difluoro-4-(propan-2-yloxy)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
3,5-difluoro-4-propan-2-yloxybenzoic acid (CAS 1344109-54-1) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 3,5-difluoro-4-propan-2-yloxybenzoic acid. InChIKey: SEOBUACMSAPVJE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 3,5-difluoro-4-propan-2-yloxybenzoic acid |
| InChIKey | SEOBUACMSAPVJE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1F)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3,5-Difluoro-4-(propan-2-yloxy)benzoic acid, 3,5-Difluoro-4-isopropoxybenzoic acid, 3,5-Difluoro-4-isopropoxybenzoicacid, 3,5-difluoro-4-propan-2-yloxybenzoic acid, 3,5-Difluoro-4-(1-methylethoxy) benzoic acid, 35-Difluoro-4-isopropoxybenzoic acid, 3,5-Difluoro-4-isopropoxy-benzoic acid, 3,5-Difluoro-4-(1-Methylethoxy)benzoic Acid, Benzoic acid, 3,5-difluoro-4-(1-methylethoxy)-