CAS 1344115-77-0 appears in our catalog under these names: 2-(Cyclopropylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(CYCLOPROPYLMETHYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE, 95%, 2-(Cyclopropylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
2-(cyclopropylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1344115-77-0) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-(cyclopropylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RCYXITFSTMSWPH-UHFFFAOYSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-(cyclopropylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RCYXITFSTMSWPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CC2 |
Computed by PubChem (NCBI)