CAS 1344362-77-1 appears in our catalog under these names: Ethyl 3-bromo-5-sulfamoylbenzoate, 95%, Ethyl 3-bromo-5-sulfamoylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Ethyl 3-bromo-5-sulfamoylbenzoate (CAS 1344362-77-1) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: ethyl 3-bromo-5-sulfamoylbenzoate. InChIKey: ATIAFQXCJHCQIQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | ethyl 3-bromo-5-sulfamoylbenzoate |
| InChIKey | ATIAFQXCJHCQIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)