Products 1344715-44-1

CAS 1344715-44-1 is the registry number for 5-Methyl-3-oxo-2,3-dihydro-1H-indene-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid (CAS 1344715-44-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid. InChIKey: XALNMUGYYROIPP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3
Molecular weight190.19 g/mol
IUPAC name5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid
InChIKeyXALNMUGYYROIPP-UHFFFAOYSA-N
SMILESCC1=C(C2=C(CCC2=O)C=C1)C(=O)O

Computed by PubChem (NCBI)