CAS 1344715-44-1 is the registry number for 5-Methyl-3-oxo-2,3-dihydro-1H-indene-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid (CAS 1344715-44-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid. InChIKey: XALNMUGYYROIPP-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 5-methyl-3-oxo-1,2-dihydroindene-4-carboxylic acid |
| InChIKey | XALNMUGYYROIPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CCC2=O)C=C1)C(=O)O |
Computed by PubChem (NCBI)