CAS 1344889-85-5 is the registry number for 5,8-Bis(trifluoromethyl)chroman-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-bis(trifluoromethyl)-2,3-dihydrochromen-4-one (CAS 1344889-85-5) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: 5,8-bis(trifluoromethyl)-2,3-dihydrochromen-4-one. InChIKey: CSKQASFTMBIIJO-UHFFFAOYSA-N.
| Molecular formula | C11H6F6O2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 5,8-bis(trifluoromethyl)-2,3-dihydrochromen-4-one |
| InChIKey | CSKQASFTMBIIJO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)