Products 155814-20-3

CAS 155814-20-3 appears in our catalog under these names: 3–(3,5–Bis(trifluoromethyl)phenyl)acrylic acid, 3-(3,5-Bis(trifluoromethyl)phenyl)acrylic acid, 3,5-Bis(trifluoromethyl)cinnamic acid, 95%, 3,5-Bis(trifluoromethyl)cinnamic acid. Offered by: GLPBio, Fluorochem, Combi-blocks, Biosynth. Available pack sizes: 100g, 25g, 5g, 1g, 0,25g, 2,5g.

Structural formula: {0} (CAS {1})

(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 155814-20-3) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: (E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: IZKCKOPHMWHBHR-OWOJBTEDSA-N.

Identity
Molecular formulaC11H6F6O2
Molecular weight284.15 g/mol
IUPAC name(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid
InChIKeyIZKCKOPHMWHBHR-OWOJBTEDSA-N
SMILESC1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)/C=C/C(=O)O

Computed by PubChem (NCBI)