Products 64287-12-3
CAS 64287-12-3 is the registry number for 4,4,5,5,5-Pentafluoro-1-(4-fluoro-phenyl)-pentane-1,3-dione, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)pentane-1,3-dione (CAS 64287-12-3) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: 4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)pentane-1,3-dione. InChIKey: JLZLYBNAGVVUJQ-UHFFFAOYSA-N.
| Molecular formula | C11H6F6O2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4,4,5,5,5-pentafluoro-1-(4-fluorophenyl)pentane-1,3-dione |
| InChIKey | JLZLYBNAGVVUJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)