CAS 94856-23-2 appears in our catalog under these names: 4,4,4-Trifluoro-1-(2-trifluoromethylphenyl)-1,3-butanedione, 95+%, 4,4,4-Trifluoro-1-(2-trifluoromethylphenyl)-1,3-butanedione, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g.
4,4,4-trifluoro-1-[2-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 94856-23-2) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: 4,4,4-trifluoro-1-[2-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: VVNAKZIRVIKGQU-UHFFFAOYSA-N.
| Molecular formula | C11H6F6O2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-[2-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | VVNAKZIRVIKGQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)