Products 312619-48-0
CAS 312619-48-0 is the registry number for 2,5-Bis(trifluoromethyl)cinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-[2,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 312619-48-0) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: (E)-3-[2,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: MSTZFZJTSGSPPB-DAFODLJHSA-N.
| Molecular formula | C11H6F6O2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | (E)-3-[2,5-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | MSTZFZJTSGSPPB-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)