CAS 1346238-10-5 appears in our catalog under these names: Febuxostat Impurity 51, Febuxostat Impurity 85, Febuxostat Impurity 24, Febuxostat Isopropyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Propan-2-yl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (CAS 1346238-10-5) is a chemical compound with the molecular formula C19H22N2O3S and a molecular weight of 358.5 g/mol. IUPAC name: propan-2-yl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: FAXOGEIYOUIHBB-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O3S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | propan-2-yl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | FAXOGEIYOUIHBB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C#N)C(=O)OC(C)C |
Computed by PubChem (NCBI)