CAS 947184-66-9 is the registry number for AZ12559322. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-(7-methyl-1-oxo-2-propan-2-yl-3H-isoindol-5-yl)phenyl]methanesulfonamide (CAS 947184-66-9) is a chemical compound with the molecular formula C19H22N2O3S and a molecular weight of 358.5 g/mol. IUPAC name: N-[3-(7-methyl-1-oxo-2-propan-2-yl-3H-isoindol-5-yl)phenyl]methanesulfonamide. InChIKey: LFBWESWBFGOART-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O3S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | N-[3-(7-methyl-1-oxo-2-propan-2-yl-3H-isoindol-5-yl)phenyl]methanesulfonamide |
| InChIKey | LFBWESWBFGOART-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=O)N(C2)C(C)C)C3=CC(=CC=C3)NS(=O)(=O)C |
Computed by PubChem (NCBI)