CAS 1349199-70-7 is the registry number for 1–Benzyl–6–tosyl–1,6–diazaspiro(3·3)heptan–3–ol. Offered by: GLPBio. Available pack sizes: 1g.
1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptan-3-ol (CAS 1349199-70-7) is a chemical compound with the molecular formula C19H22N2O3S and a molecular weight of 358.5 g/mol. IUPAC name: 1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptan-3-ol. InChIKey: LGWSZRHTXSQOOE-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O3S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptan-3-ol |
| InChIKey | LGWSZRHTXSQOOE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(C2)C(CN3CC4=CC=CC=C4)O |
Computed by PubChem (NCBI)