Products 73096-28-3
CAS 73096-28-3 is the registry number for (S)-N-(p-Tolyl)-1-tosylpyrrolidine-2-carboxamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
(2S)-N-(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (CAS 73096-28-3) is a chemical compound with the molecular formula C19H22N2O3S and a molecular weight of 358.5 g/mol. IUPAC name: (2S)-N-(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide. InChIKey: XYKCBZPQCNUOFV-SFHVURJKSA-N.
| Molecular formula | C19H22N2O3S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | (2S)-N-(4-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| InChIKey | XYKCBZPQCNUOFV-SFHVURJKSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)[C@@H]2CCCN2S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)