CAS 180977-03-1 is the registry number for N-(4-Amino-2-phenylbenzoyl)methionine methyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2S)-2-[(4-amino-2-phenylbenzoyl)amino]-4-methylsulfanylbutanoate (CAS 180977-03-1) is a chemical compound with the molecular formula C19H22N2O3S and a molecular weight of 358.5 g/mol. IUPAC name: methyl (2S)-2-[(4-amino-2-phenylbenzoyl)amino]-4-methylsulfanylbutanoate. InChIKey: MCSVVHVRYQWPDV-KRWDZBQOSA-N.
| Molecular formula | C19H22N2O3S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | methyl (2S)-2-[(4-amino-2-phenylbenzoyl)amino]-4-methylsulfanylbutanoate |
| InChIKey | MCSVVHVRYQWPDV-KRWDZBQOSA-N |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)C1=C(C=C(C=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)