Products 1346446-86-3
CAS 1346446-86-3 is the registry number for (6-Bromo-7-methoxyfuro[3,2-c]pyridin-2-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(6-bromo-7-methoxyfuro[3,2-c]pyridin-2-yl)methanol (CAS 1346446-86-3) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: (6-bromo-7-methoxyfuro[3,2-c]pyridin-2-yl)methanol. InChIKey: XDQSVJUQVZJQMK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | (6-bromo-7-methoxyfuro[3,2-c]pyridin-2-yl)methanol |
| InChIKey | XDQSVJUQVZJQMK-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CN=C1Br)C=C(O2)CO |
Computed by PubChem (NCBI)