CAS 1383920-96-4 is the registry number for 3-Hydroxy-6,3',4',5'-tetramethoxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
3-hydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (CAS 1383920-96-4) is a chemical compound with the molecular formula C19H18O7 and a molecular weight of 358.3 g/mol. IUPAC name: 3-hydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: ZVSFWMIWPLDDCL-UHFFFAOYSA-N.
| Molecular formula | C19H18O7 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 3-hydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | ZVSFWMIWPLDDCL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C(C2=O)O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)