CAS 1346600-21-2 appears in our catalog under these names: Alphenal-d5, Alphenal–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 10mg.
5-(2,3,4,5,6-pentadeuteriophenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (CAS 1346600-21-2) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 249.28 g/mol. IUPAC name: 5-(2,3,4,5,6-pentadeuteriophenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione. InChIKey: WOIGZSBYKGQJGL-DKFMXDSJSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 249.28 g/mol |
| IUPAC name | 5-(2,3,4,5,6-pentadeuteriophenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| InChIKey | WOIGZSBYKGQJGL-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(C(=O)NC(=O)NC2=O)CC=C)[2H])[2H] |
Computed by PubChem (NCBI)