Products 1346600-79-0
CAS 1346600-79-0 is the registry number for Sumatriptan EP Impurity B-d3. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-1-[3-[2-(trideuteriomethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide (CAS 1346600-79-0) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 284.39 g/mol. IUPAC name: N-methyl-1-[3-[2-(trideuteriomethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide. InChIKey: YDTVAJYBEHCVJY-FIBGUPNXSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | N-methyl-1-[3-[2-(trideuteriomethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide |
| InChIKey | YDTVAJYBEHCVJY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)NC |
Computed by PubChem (NCBI)