Products 1346603-61-9
CAS 1346603-61-9 appears in our catalog under these names: 3-Hydroxy Detomidine-15N2,d2 Hydrochloride, 3-Hydroxy detomidine-15N2,d2 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
[3-[dideuterio((1,3-15N2)1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride (CAS 1346603-61-9) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 242.71 g/mol. IUPAC name: [3-[dideuterio((1,3-15N2)1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride. InChIKey: JHQUAWVVRURKMP-WKHLXQDESA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 242.71 g/mol |
| IUPAC name | [3-[dideuterio((1,3-15N2)1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride |
| InChIKey | JHQUAWVVRURKMP-WKHLXQDESA-N |
| SMILES | [2H]C([2H])(C1=C(C(=CC=C1)CO)C)C2=C[15N]=C[15NH]2.Cl |
Computed by PubChem (NCBI)