Products 2733387-95-4
CAS 2733387-95-4 is the registry number for 3-Hydroxy Detomidine-d4 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
Dideuterio-[3-[dideuterio(1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride (CAS 2733387-95-4) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: dideuterio-[3-[dideuterio(1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride. InChIKey: JHQUAWVVRURKMP-YPUXZZOMSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | dideuterio-[3-[dideuterio(1H-imidazol-5-yl)methyl]-2-methylphenyl]methanol;hydrochloride |
| InChIKey | JHQUAWVVRURKMP-YPUXZZOMSA-N |
| SMILES | [2H]C([2H])(C1=C(C(=CC=C1)C([2H])([2H])O)C)C2=CN=CN2.Cl |
Computed by PubChem (NCBI)