CAS 1346603-94-8 is the registry number for N-Demethoxy Linuron-13C6. Offered by: TRC. Available pack sizes: 50mg.
1-(3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-methylurea (CAS 1346603-94-8) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 225.02 g/mol. IUPAC name: 1-(3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-methylurea. InChIKey: IDQHRQQSSQDLTR-WBJZHHNVSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 225.02 g/mol |
| IUPAC name | 1-(3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-methylurea |
| InChIKey | IDQHRQQSSQDLTR-WBJZHHNVSA-N |
| SMILES | CNC(=O)N[13C]1=[13CH][13C](=[13C]([13CH]=[13CH]1)Cl)Cl |
Computed by PubChem (NCBI)