Products 1346604-62-3
CAS 1346604-62-3 is the registry number for Epinephrine-d3 Sulfate. Offered by: TRC. Available pack sizes: 25mg.
[2-hydroxy-4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenyl] hydrogen sulfate (CAS 1346604-62-3) is a chemical compound with the molecular formula C9H13NO6S and a molecular weight of 266.29 g/mol. IUPAC name: [2-hydroxy-4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenyl] hydrogen sulfate. InChIKey: AELFRHHZGTVYGJ-FIBGUPNXSA-N.
| Molecular formula | C9H13NO6S |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | [2-hydroxy-4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenyl] hydrogen sulfate |
| InChIKey | AELFRHHZGTVYGJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC(=C(C=C1)OS(=O)(=O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Epinephrine-d3 Sulfate, Epinephrine-d3Sulfate