Products 2448348-57-8
CAS 2448348-57-8 is the registry number for 4-(2-(Methylamino)-1-(sulfooxy)ethyl)-1,2-benzenediol. Offered by: TRC. Available pack sizes: 100mg.
[1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate (CAS 2448348-57-8) is a chemical compound with the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. IUPAC name: [1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate. InChIKey: CIMTYANHJMAKQX-UHFFFAOYSA-N.
| Molecular formula | C9H13NO6S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | [1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate |
| InChIKey | CIMTYANHJMAKQX-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=C(C=C1)O)O)OS(=O)(=O)O |
Computed by PubChem (NCBI)