Products 2469755-95-9
CAS 2469755-95-9 is the registry number for Norepinephrine Impurity 44. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2,3-dihydroxy-5-[1-hydroxy-2-(methylamino)ethyl]benzenesulfonic acid (CAS 2469755-95-9) is a chemical compound with the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. IUPAC name: 2,3-dihydroxy-5-[1-hydroxy-2-(methylamino)ethyl]benzenesulfonic acid. InChIKey: VTQSYJXUXXJECU-UHFFFAOYSA-N.
| Molecular formula | C9H13NO6S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2,3-dihydroxy-5-[1-hydroxy-2-(methylamino)ethyl]benzenesulfonic acid |
| InChIKey | VTQSYJXUXXJECU-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=C(C(=C1)S(=O)(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
rac Epinephrine-5-Sulfonate, 2,3-dihydroxy-5-(1-hydroxy-2-(methylamino)ethyl)benzenesulfonic acid, 2,3-Dihydroxy-5-[1-hydroxy-2-(methylamino)ethyl]benzenesulfonic acid, Norepinephrine impurity 143, Noradrenaline (Norepinephrine) Impurity 127, Benzenesulfonic acid, 2,3-dihydroxy-5-[1-hydroxy-2-(methylamino)ethyl]-