CAS 139183-81-6 appears in our catalog under these names: Adrenaline Impurity 20, Epinephrine Impurity 4, 4-((1R)-2-(Methylamino)-1-(sulfooxy)ethyl)-1,2-benzenediol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[(1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate (CAS 139183-81-6) is a chemical compound with the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. IUPAC name: [(1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate. InChIKey: CIMTYANHJMAKQX-VIFPVBQESA-N.
| Molecular formula | C9H13NO6S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | [(1R)-1-(3,4-dihydroxyphenyl)-2-(methylamino)ethyl] hydrogen sulfate |
| InChIKey | CIMTYANHJMAKQX-VIFPVBQESA-N |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)OS(=O)(=O)O |
Computed by PubChem (NCBI)