Products 21093-18-5
CAS 21093-18-5 appears in our catalog under these names: Epinephrine Sulfate, Norepinephrine Impurity 41, Epinephrine 4-O-Sulfate Ester, >95% (HPLC), Epinephrine Sulfate, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 2,5mg.
[2-hydroxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate (CAS 21093-18-5) is a chemical compound with the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. IUPAC name: [2-hydroxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate. InChIKey: AELFRHHZGTVYGJ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO6S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | [2-hydroxy-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] hydrogen sulfate |
| InChIKey | AELFRHHZGTVYGJ-UHFFFAOYSA-N |
| SMILES | CNCC(C1=CC(=C(C=C1)OS(=O)(=O)O)O)O |
Computed by PubChem (NCBI)