Products 1346605-26-2
CAS 1346605-26-2 appears in our catalog under these names: rac-Hesperetin-d3, rac–Hesperetin–d3, (Rac)-Hesperetin-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 10 mg.
5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-2,3-dihydrochromen-4-one (CAS 1346605-26-2) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 305.30 g/mol. IUPAC name: 5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-2,3-dihydrochromen-4-one. InChIKey: AIONOLUJZLIMTK-FIBGUPNXSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 305.30 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]-2,3-dihydrochromen-4-one |
| InChIKey | AIONOLUJZLIMTK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)