Products 2750534-85-9
CAS 2750534-85-9 is the registry number for (Rac)-Hesperetin-13C,d3, 99.3%. Offered by: MedChemExpress. Available pack sizes: 500 μg, 1 mg.
5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]-2,3-dihydrochromen-4-one (CAS 2750534-85-9) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 306.29 g/mol. IUPAC name: 5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]-2,3-dihydrochromen-4-one. InChIKey: AIONOLUJZLIMTK-KQORAOOSSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 306.29 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]-2,3-dihydrochromen-4-one |
| InChIKey | AIONOLUJZLIMTK-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)