Products 134779-20-7
CAS 134779-20-7 is the registry number for O-Methylmurrayamine A. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole (CAS 134779-20-7) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: 9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole. InChIKey: GDQWCFKJPYSDDG-UHFFFAOYSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 9-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole |
| InChIKey | GDQWCFKJPYSDDG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C1OC(C=C3)(C)C)NC4=C2C=CC(=C4)OC |
Computed by PubChem (NCBI)