CAS 134865-33-1 is the registry number for Meluadrine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol (CAS 134865-33-1) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol. InChIKey: LIXBJWRFCNRAPA-NSHDSACASA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol |
| InChIKey | LIXBJWRFCNRAPA-NSHDSACASA-N |
| SMILES | CC(C)(C)NC[C@@H](C1=C(C=C(C=C1)O)Cl)O |
Computed by PubChem (NCBI)