CAS 58020-43-2 appears in our catalog under these names: HOKU–81, HOKU-81, ≥98%, ≥98%, HOKU-81 (Standard), HOKU-81, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, Get quote, 100 mg.
4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol (CAS 58020-43-2) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol. InChIKey: LIXBJWRFCNRAPA-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol |
| InChIKey | LIXBJWRFCNRAPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=C(C=C(C=C1)O)Cl)O |
Computed by PubChem (NCBI)