CAS 134997-98-1 is the registry number for 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-6-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxo-4H-1,4-benzothiazine-6-carbonitrile (CAS 134997-98-1) is a chemical compound with the molecular formula C9H6N2OS and a molecular weight of 190.22 g/mol. IUPAC name: 3-oxo-4H-1,4-benzothiazine-6-carbonitrile. InChIKey: LTDRTQDXNDOKHG-UHFFFAOYSA-N.
| Molecular formula | C9H6N2OS |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzothiazine-6-carbonitrile |
| InChIKey | LTDRTQDXNDOKHG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)