CAS 99066-69-0 appears in our catalog under these names: 5-Phenyl-1,3,4-thiadiazole-2-carbaldehyde, 97%, 5-Phenyl-1,3,4-thiadiazole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-phenyl-1,3,4-thiadiazole-2-carbaldehyde (CAS 99066-69-0) is a chemical compound with the molecular formula C9H6N2OS and a molecular weight of 190.22 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazole-2-carbaldehyde. InChIKey: SKGLVVWEUSDARD-UHFFFAOYSA-N.
| Molecular formula | C9H6N2OS |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazole-2-carbaldehyde |
| InChIKey | SKGLVVWEUSDARD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)C=O |
Computed by PubChem (NCBI)