CAS 74772-19-3 is the registry number for Pyrrolo[1,2-a]thieno[2,3-e]pyrazin-5(4H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-8-one (CAS 74772-19-3) is a chemical compound with the molecular formula C9H6N2OS and a molecular weight of 190.22 g/mol. IUPAC name: 5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-8-one. InChIKey: YJZPRJSOQIEXAB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2OS |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-8-one |
| InChIKey | YJZPRJSOQIEXAB-UHFFFAOYSA-N |
| SMILES | C1=CN2C3=C(NC(=O)C2=C1)SC=C3 |
Computed by PubChem (NCBI)