CAS 3042-01-1 appears in our catalog under these names: [1,3]Thiazolo[3,2-a]benzimidazol-3(2h)-one, 95%, Benzo[4,5]imidazo[2,1-b]thiazol-3(2H)-one 97%, Benzo[4,5]imidazo[2,1-b]thiazol-3(2H)-one, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
[1,3]thiazolo[3,2-a]benzimidazol-1-one (CAS 3042-01-1) is a chemical compound with the molecular formula C9H6N2OS and a molecular weight of 190.22 g/mol. IUPAC name: [1,3]thiazolo[3,2-a]benzimidazol-1-one. InChIKey: CFXICROPFOOZFI-UHFFFAOYSA-N.
| Molecular formula | C9H6N2OS |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | [1,3]thiazolo[3,2-a]benzimidazol-1-one |
| InChIKey | CFXICROPFOOZFI-UHFFFAOYSA-N |
| SMILES | C1C(=O)N2C3=CC=CC=C3N=C2S1 |
Computed by PubChem (NCBI)