CAS 801226-13-1 is the registry number for 4-(2-Furanyl)-2-thiazoleacetonitrile. Offered by: TRC. Available pack sizes: 100mg.
2-[4-(furan-2-yl)-1,3-thiazol-2-yl]acetonitrile (CAS 801226-13-1) is a chemical compound with the molecular formula C9H6N2OS and a molecular weight of 190.22 g/mol. IUPAC name: 2-[4-(furan-2-yl)-1,3-thiazol-2-yl]acetonitrile. InChIKey: KMTFETAVDZVCIB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2OS |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2-[4-(furan-2-yl)-1,3-thiazol-2-yl]acetonitrile |
| InChIKey | KMTFETAVDZVCIB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CSC(=N2)CC#N |
Computed by PubChem (NCBI)