Products 1349988-73-3
CAS 1349988-73-3 appears in our catalog under these names: 5-Methyl-1-(pyridin-3-yl)-1h-pyrazole-3-carboxylic acid, 95%, 5-Methyl-1-(pyridin-3-yl)-1H-pyrazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
5-methyl-1-pyridin-3-ylpyrazole-3-carboxylic acid (CAS 1349988-73-3) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 5-methyl-1-pyridin-3-ylpyrazole-3-carboxylic acid. InChIKey: JJCQDUIHVRSJKQ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-methyl-1-pyridin-3-ylpyrazole-3-carboxylic acid |
| InChIKey | JJCQDUIHVRSJKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CN=CC=C2)C(=O)O |
Computed by PubChem (NCBI)