CAS 1350206-14-2 appears in our catalog under these names: Etoricoxib Impurity 26, Deschloro Etoricoxib, 6'-Methyl-3-(4-(methylsulfonyl)phenyl)-2,3'-bipyridine (Etoricoxib Impurity), 98%, 98%, Etoricoxib impurity 26, 98.75%, 6'-Methyl-3-(4-(methylsulfonyl)phenyl)-2,3'-bipyridine (Etoricoxib Impurity), 98%. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 250mg, 50mg, 25 mg, 5 mg, 10 mg, 50 mg, 100mg.
2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine (CAS 1350206-14-2) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: 2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine. InChIKey: DJQFDIJHIDCKJV-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-(6-methyl-3-pyridinyl)-3-(4-methylsulfonylphenyl)pyridine |
| InChIKey | DJQFDIJHIDCKJV-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=C(C=CC=N2)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)