CAS 19350-74-4 is the registry number for 4-Methyl-n-(naphthalene-2-ylmethylene)benzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide (CAS 19350-74-4) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: 4-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide. InChIKey: UATKKUXPHAFHLV-CPNJWEJPSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide |
| InChIKey | UATKKUXPHAFHLV-CPNJWEJPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)