Products 333436-43-4
CAS 333436-43-4 appears in our catalog under these names: N-(4-(4-Methoxyphenyl)thiazol-2-yl)-2-phenylacetamide, 95%, 95%, A3AR antagonist 5, A3AR antagonist 5, 98.17%. Offered by: Chemat, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg, 100 mg.
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-phenylacetamide (CAS 333436-43-4) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-phenylacetamide. InChIKey: RZHUYMVTMZMVDE-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-phenylacetamide |
| InChIKey | RZHUYMVTMZMVDE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)