Products 1992834-72-6
CAS 1992834-72-6 is the registry number for tert-Butyl 2-cyano-10H-phenothiazine-10-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-cyanophenothiazine-10-carboxylate (CAS 1992834-72-6) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: tert-butyl 2-cyanophenothiazine-10-carboxylate. InChIKey: IRFWDEXYUDBNSN-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | tert-butyl 2-cyanophenothiazine-10-carboxylate |
| InChIKey | IRFWDEXYUDBNSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2SC3=C1C=C(C=C3)C#N |
Computed by PubChem (NCBI)