CAS 640727-84-0 appears in our catalog under these names: 5-(4-Methylsulfanyl-phenyl)-1-phenyl-1h-pyrazole-3-carboxylic acid methyl ester, 95%, Methyl 5-(4-(methylthio)phenyl)-1-phenyl-1H-pyrazole-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylate (CAS 640727-84-0) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: methyl 5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylate. InChIKey: QYLOXGWSCGOQPH-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | methyl 5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylate |
| InChIKey | QYLOXGWSCGOQPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=C1)C2=CC=C(C=C2)SC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)