CAS 13504-85-3 appears in our catalog under these names: Z–Hyp–OH, Z-L-trans-Hyp-OH, trans-N-Carbobenzoxy-4-hydroxy-L-proline, >98.0%(HPLC)(T), Cbz-Hyp-OH 95%, Z-HYP-OH, >=99.0% T. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 10g, 500g, 1kg, 1g, 10 g.
(2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 13504-85-3) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: (2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: WWVCWLBEARZMAH-MNOVXSKESA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | WWVCWLBEARZMAH-MNOVXSKESA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)