CAS 313706-21-7 appears in our catalog under these names: Trans-1,2-pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester, 95%, rel–(2R,4S)–1–((Benzyloxy)carbonyl)–4–hydroxypyrrolidine–2–carboxylic acid, Cbz-D-trans-Hyp-OH 95%, TRANS-1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-HYDROXY-, 1-(PHENYLMETHYL) ESTER, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R,4S)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 313706-21-7) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: (2R,4S)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: WWVCWLBEARZMAH-WDEREUQCSA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (2R,4S)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | WWVCWLBEARZMAH-WDEREUQCSA-N |
| SMILES | C1[C@@H](CN([C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)