Products 39629-91-9

CAS 39629-91-9 is the registry number for 1-(3,4-Dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 39629-91-9) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: AFHZUDVQQAPRFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO5
Molecular weight265.26 g/mol
IUPAC name1-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyAFHZUDVQQAPRFQ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)N2CC(CC2=O)C(=O)O)OC

Computed by PubChem (NCBI)