CAS 87661-91-4 is the registry number for 4-Acetyl-2-nitrophenyl pivalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-acetyl-2-nitrophenyl) 2,2-dimethylpropanoate (CAS 87661-91-4) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: (4-acetyl-2-nitrophenyl) 2,2-dimethylpropanoate. InChIKey: JATDOCLUHNJROO-UHFFFAOYSA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | (4-acetyl-2-nitrophenyl) 2,2-dimethylpropanoate |
| InChIKey | JATDOCLUHNJROO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC(=O)C(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)