Products 133749-24-3

CAS 133749-24-3 is the registry number for 1-(2,4-Dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 133749-24-3) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: 1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: MXNQXFPGGPZDQK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO5
Molecular weight265.26 g/mol
IUPAC name1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyMXNQXFPGGPZDQK-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)N2CC(CC2=O)C(=O)O)OC

Computed by PubChem (NCBI)