CAS 135065-47-3 is the registry number for 6-Chloro-7-hydroxy-3,4-dimethyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-7-hydroxy-3,4-dimethylchromen-2-one (CAS 135065-47-3) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 6-chloro-7-hydroxy-3,4-dimethylchromen-2-one. InChIKey: JMNRODDUVWGJDN-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 6-chloro-7-hydroxy-3,4-dimethylchromen-2-one |
| InChIKey | JMNRODDUVWGJDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=CC(=C(C=C12)Cl)O)C |
Computed by PubChem (NCBI)