CAS 879475-90-8 appears in our catalog under these names: (5-Chloro-6-methyl-1-benzofuran-3-yl)acetic acid, 95%, 2-(5-Chloro-6-methylbenzofuran-3-yl)acetic acid 95+%, 2-(5-Chloro-6-methylbenzofuran-3-yl)acetic acid, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetic acid (CAS 879475-90-8) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetic acid. InChIKey: LJUUKSDHSFDRBS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-(5-chloro-6-methyl-1-benzofuran-3-yl)acetic acid |
| InChIKey | LJUUKSDHSFDRBS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=CO2)CC(=O)O |
Computed by PubChem (NCBI)