CAS 53911-68-5 appears in our catalog under these names: 4-(4-Chlorophenyl)dihydro-2h-pyran-2,6(3h)-dione, 95%, Baclofen Impurity 4, 3-(4-Chlorophenyl)glutaric Anhydride, 4-(4-Chlorophenyl)tetrahydropyran-2,6-dione, 4-(4-Chlorophenyl)dihydro-2H-pyran-2,6(3H)-dione 96%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 250mg, 5g, 25g, 100mg, 1g, on request, 500mg, 25mg.
4-(4-chlorophenyl)oxane-2,6-dione (CAS 53911-68-5) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 4-(4-chlorophenyl)oxane-2,6-dione. InChIKey: OCZRLOJECISNAO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-(4-chlorophenyl)oxane-2,6-dione |
| InChIKey | OCZRLOJECISNAO-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)OC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)